C17H18FN3O5 — CID 91821632
methyl 2-[[2-[3-(2-fluoro-4-methoxyphenyl)-6-oxopyridazin-1-yl]acetyl]amino]propanoate (PubChem CID 91821632) has the molecular formula C17H18FN3O5 and a molecular weight of 363.35 g/mol. Its IUPAC name is methyl 2-[[2-[3-(2-fluoro-4-methoxyphenyl)-6-oxopyridazin-1-yl]acetyl]amino]propanoate.
| Compound Name | methyl 2-[[2-[3-(2-fluoro-4-methoxyphenyl)-6-oxopyridazin-1-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 91821632 |
| Molecular Formula | C17H18FN3O5 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl 2-[[2-[3-(2-fluoro-4-methoxyphenyl)-6-oxopyridazin-1-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)Cn1nc(-c2ccc(OC)cc2F)ccc1=O |
| InChI | InChI=1S/C17H18FN3O5/c1-10(17(24)26-3)19-15(22)9-21-16(23)7-6-14(20-21)12-5-4-11(25-2)8-13(12)18/h4-8,10H,9H2,1-3H3,(H,19,22) |
| InChIKey | LWMBDXXFZSIZMT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |