C21H28N4O4S — CID 91821637
5-[[cyclohexyl(methyl)amino]-(2,3,4-trimethoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 91821637) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-[[cyclohexyl(methyl)amino]-(2,3,4-trimethoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[[cyclohexyl(methyl)amino]-(2,3,4-trimethoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 91821637 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-[[cyclohexyl(methyl)amino]-(2,3,4-trimethoxyphenyl)methyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | COc1ccc(C(c2sc3ncnn3c2O)N(C)C2CCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C21H28N4O4S/c1-24(13-8-6-5-7-9-13)16(19-20(26)25-21(30-19)22-12-23-25)14-10-11-15(27-2)18(29-4)17(14)28-3/h10-13,16,26H,5-9H2,1-4H3 |
| InChIKey | DTVJKSGJANEMOM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |