About methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate
methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate (PubChem CID 91824106) has the molecular formula C7H12ClNO3
and a molecular weight of 193.63 g/mol. Its IUPAC name is methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate |
| PubChem CID | 91824106 |
| Molecular Formula | C7H12ClNO3 |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate |
| SMILES | COC(=O)CCC1CC(Cl)NO1 |
| InChI | InChI=1S/C7H12ClNO3/c1-11-7(10)3-2-5-4-6(8)9-12-5/h5-6,9H,2-4H2,1H3 |
| InChIKey | LIDQNNAKNZIQBC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate?
The IUPAC name of methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate (CID 91824106) is methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate.
What is the SMILES notation for methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate?
The canonical SMILES for methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate is COC(=O)CCC1CC(Cl)NO1.
What is the InChIKey of methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate?
The InChIKey is LIDQNNAKNZIQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO3/c1-11-7(10)3-2-5-4-6(8)9-12-5/h5-6,9H,2-4H2,1H3.
What are the key properties of methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate?
methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate has a molecular weight of 193.63 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-chloro-1,2-oxazolidin-5-yl)propanoate is sourced from PubChem (CID 91824106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).