About 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione
1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 91824265) has the molecular formula C7H11FN4O2
and a molecular weight of 202.19 g/mol. Its IUPAC name is 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 91824265 |
| Molecular Formula | C7H11FN4O2 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | NC[C@@H](N)Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H11FN4O2/c8-5-3-12(2-4(10)1-9)7(14)11-6(5)13/h3-4H,1-2,9-10H2,(H,11,13,14)/t4-/m1/s1 |
| InChIKey | ZBKWVMMCABYTAU-SCSAIBSYSA-N |
| XLogP | -2.04 |
| TPSA | 106.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione (CID 91824265) is 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione is NC[C@@H](N)Cn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is ZBKWVMMCABYTAU-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H11FN4O2/c8-5-3-12(2-4(10)1-9)7(14)11-6(5)13/h3-4H,1-2,9-10H2,(H,11,13,14)/t4-/m1/s1.
What are the key properties of 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione?
1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 202.19 g/mol, XLogP of -2.04, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2,3-diaminopropyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 91824265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).