C8H9N5O3 — CID 91824302
2-amino-3,8-dimethyl-5H-pteridine-4,6,7-trione (PubChem CID 91824302) has the molecular formula C8H9N5O3 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-amino-3,8-dimethyl-5H-pteridine-4,6,7-trione.
| Compound Name | 2-amino-3,8-dimethyl-5H-pteridine-4,6,7-trione |
|---|---|
| PubChem CID | 91824302 |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-amino-3,8-dimethyl-5H-pteridine-4,6,7-trione |
| SMILES | Cn1c(N)nc2c([nH]c(=O)c(=O)n2C)c1=O |
| InChI | InChI=1S/C8H9N5O3/c1-12-4-3(10-5(14)7(12)16)6(15)13(2)8(9)11-4/h1-2H3,(H2,9,11)(H,10,14) |
| InChIKey | GTUHLTAKGAZGMY-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|