About 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone
1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone (PubChem CID 91824304) has the molecular formula C8H12N6O
and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone |
| PubChem CID | 91824304 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone |
| SMILES | CC(=O)N1CCNc2nc(N)nc(N)c21 |
| InChI | InChI=1S/C8H12N6O/c1-4(15)14-3-2-11-7-5(14)6(9)12-8(10)13-7/h2-3H2,1H3,(H5,9,10,11,12,13) |
| InChIKey | UJOCHXSZBWVPEH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The IUPAC name of 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone (CID 91824304) is 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone.
What is the SMILES notation for 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The canonical SMILES for 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone is CC(=O)N1CCNc2nc(N)nc(N)c21.
What is the InChIKey of 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone?
The InChIKey is UJOCHXSZBWVPEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O/c1-4(15)14-3-2-11-7-5(14)6(9)12-8(10)13-7/h2-3H2,1H3,(H5,9,10,11,12,13).
What are the key properties of 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone?
1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone has a molecular weight of 208.22 g/mol, XLogP of -0.58, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-diamino-7,8-dihydro-6H-pteridin-5-yl)ethanone is sourced from PubChem (CID 91824304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).