About (5-amino-2-methylphenyl) 4-methylbenzenesulfonate
(5-amino-2-methylphenyl) 4-methylbenzenesulfonate (PubChem CID 91824318) has the molecular formula C14H15NO3S
and a molecular weight of 277.35 g/mol. Its IUPAC name is (5-amino-2-methylphenyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (5-amino-2-methylphenyl) 4-methylbenzenesulfonate |
| PubChem CID | 91824318 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (5-amino-2-methylphenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(N)ccc2C)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-3-7-13(8-4-10)19(16,17)18-14-9-12(15)6-5-11(14)2/h3-9H,15H2,1-2H3 |
| InChIKey | RFXWYEQLTGUECS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-2-methylphenyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2-methylphenyl) 4-methylbenzenesulfonate?
The IUPAC name of (5-amino-2-methylphenyl) 4-methylbenzenesulfonate (CID 91824318) is (5-amino-2-methylphenyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (5-amino-2-methylphenyl) 4-methylbenzenesulfonate?
The canonical SMILES for (5-amino-2-methylphenyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2cc(N)ccc2C)cc1.
What is the InChIKey of (5-amino-2-methylphenyl) 4-methylbenzenesulfonate?
The InChIKey is RFXWYEQLTGUECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-10-3-7-13(8-4-10)19(16,17)18-14-9-12(15)6-5-11(14)2/h3-9H,15H2,1-2H3.
What are the key properties of (5-amino-2-methylphenyl) 4-methylbenzenesulfonate?
(5-amino-2-methylphenyl) 4-methylbenzenesulfonate has a molecular weight of 277.35 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2-methylphenyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 91824318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).