C20H20N2O4S — CID 91824604
2-[(6-propoxynaphthalen-2-yl)sulfonylamino]benzamide (PubChem CID 91824604) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[(6-propoxynaphthalen-2-yl)sulfonylamino]benzamide.
| Compound Name | 2-[(6-propoxynaphthalen-2-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 91824604 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[(6-propoxynaphthalen-2-yl)sulfonylamino]benzamide |
| SMILES | CCCOc1ccc2cc(S(=O)(=O)Nc3ccccc3C(N)=O)ccc2c1 |
| InChI | InChI=1S/C20H20N2O4S/c1-2-11-26-16-9-7-15-13-17(10-8-14(15)12-16)27(24,25)22-19-6-4-3-5-18(19)20(21)23/h3-10,12-13,22H,2,11H2,1H3,(H2,21,23) |
| InChIKey | MZGZTOKEWMHNCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |