About (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone
(2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone (PubChem CID 91824809) has the molecular formula C19H14N2O3
and a molecular weight of 318.33 g/mol. Its IUPAC name is (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone.
Molecular Properties
| Compound Name | (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone |
| PubChem CID | 91824809 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone |
| SMILES | COc1ccc(O)c(C(=O)c2cnc3[nH]c4ccccc4c3c2)c1 |
| InChI | InChI=1S/C19H14N2O3/c1-24-12-6-7-17(22)15(9-12)18(23)11-8-14-13-4-2-3-5-16(13)21-19(14)20-10-11/h2-10,22H,1H3,(H,20,21) |
| InChIKey | VXJGEBHBMOMZDB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone?
The IUPAC name of (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone (CID 91824809) is (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone.
What is the SMILES notation for (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone?
The canonical SMILES for (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone is COc1ccc(O)c(C(=O)c2cnc3[nH]c4ccccc4c3c2)c1.
What is the InChIKey of (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone?
The InChIKey is VXJGEBHBMOMZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c1-24-12-6-7-17(22)15(9-12)18(23)11-8-14-13-4-2-3-5-16(13)21-19(14)20-10-11/h2-10,22H,1H3,(H,20,21).
What are the key properties of (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone?
(2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone has a molecular weight of 318.33 g/mol, XLogP of 3.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-methoxyphenyl)-(9H-pyrido[2,3-b]indol-3-yl)methanone is sourced from PubChem (CID 91824809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).