C8H12O11P-3 — CID 91825728
(2R,4R,5R,6R)-2,4,5-trihydroxy-6-[(1R)-1-hydroxy-2-phosphonatooxyethyl]oxane-2-carboxylate (PubChem CID 91825728) has the molecular formula C8H12O11P-3 and a molecular weight of 315.15 g/mol. Its IUPAC name is (2R,4R,5R,6R)-2,4,5-trihydroxy-6-[(1R)-1-hydroxy-2-phosphonatooxyethyl]oxane-2-carboxylate.
| Compound Name | (2R,4R,5R,6R)-2,4,5-trihydroxy-6-[(1R)-1-hydroxy-2-phosphonatooxyethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 91825728 |
| Molecular Formula | C8H12O11P-3 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (2R,4R,5R,6R)-2,4,5-trihydroxy-6-[(1R)-1-hydroxy-2-phosphonatooxyethyl]oxane-2-carboxylate |
| SMILES | O=C([O-])[C@@]1(O)C[C@@H](O)[C@@H](O)[C@@H]([C@H](O)COP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C8H15O11P/c9-3-1-8(14,7(12)13)19-6(5(3)11)4(10)2-18-20(15,16)17/h3-6,9-11,14H,1-2H2,(H,12,13)(H2,15,16,17)/p-3/t3-,4-,5-,6-,8-/m1/s1 |
| InChIKey | IZZNRKJLBIYBJN-HXUQBWEZSA-K |
| XLogP | -5.86 |
| TPSA | 202.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|