About methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate
methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate (PubChem CID 91825963) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate |
| PubChem CID | 91825963 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(O)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H15NO3/c1-17-13(16)11-8-14(9-12(11)15)7-10-5-3-2-4-6-10/h2-6,15H,7-9H2,1H3 |
| InChIKey | LDAJUXIYLHYVAL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate?
The IUPAC name of methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate (CID 91825963) is methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate.
What is the SMILES notation for methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate?
The canonical SMILES for methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate is COC(=O)C1=C(O)CN(Cc2ccccc2)C1.
What is the InChIKey of methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate?
The InChIKey is LDAJUXIYLHYVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-17-13(16)11-8-14(9-12(11)15)7-10-5-3-2-4-6-10/h2-6,15H,7-9H2,1H3.
What are the key properties of methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate?
methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzyl-4-hydroxy-2,5-dihydropyrrole-3-carboxylate is sourced from PubChem (CID 91825963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).