C20H25FN2O — CID 91826181
(E)-N-[(1R,2S,3R,6S)-2-fluoro-3-methyl-6-propan-2-ylcyclohexyl]oxy-1-quinolin-8-ylmethanimine (PubChem CID 91826181) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is (E)-N-[(1R,2S,3R,6S)-2-fluoro-3-methyl-6-propan-2-ylcyclohexyl]oxy-1-quinolin-8-ylmethanimine.
| Compound Name | (E)-N-[(1R,2S,3R,6S)-2-fluoro-3-methyl-6-propan-2-ylcyclohexyl]oxy-1-quinolin-8-ylmethanimine |
|---|---|
| PubChem CID | 91826181 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (E)-N-[(1R,2S,3R,6S)-2-fluoro-3-methyl-6-propan-2-ylcyclohexyl]oxy-1-quinolin-8-ylmethanimine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@H](F)[C@@H]1O/N=C/c1cccc2cccnc12 |
| InChI | InChI=1S/C20H25FN2O/c1-13(2)17-10-9-14(3)18(21)20(17)24-23-12-16-7-4-6-15-8-5-11-22-19(15)16/h4-8,11-14,17-18,20H,9-10H2,1-3H3/b23-12+/t14-,17+,18+,20-/m1/s1 |
| InChIKey | YDHQTPLZOFPOHP-IJGOMABFSA-N |
| XLogP | 4.99 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|