C20H25FN2O — CID 91826193
(E)-N-[(1R,2R)-4-tert-butyl-2-fluorocyclohexyl]oxy-1-quinolin-8-ylmethanimine (PubChem CID 91826193) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is (E)-N-[(1R,2R)-4-tert-butyl-2-fluorocyclohexyl]oxy-1-quinolin-8-ylmethanimine.
| Compound Name | (E)-N-[(1R,2R)-4-tert-butyl-2-fluorocyclohexyl]oxy-1-quinolin-8-ylmethanimine |
|---|---|
| PubChem CID | 91826193 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (E)-N-[(1R,2R)-4-tert-butyl-2-fluorocyclohexyl]oxy-1-quinolin-8-ylmethanimine |
| SMILES | CC(C)(C)C1CC[C@@H](O/N=C/c2cccc3cccnc23)[C@H](F)C1 |
| InChI | InChI=1S/C20H25FN2O/c1-20(2,3)16-9-10-18(17(21)12-16)24-23-13-15-7-4-6-14-8-5-11-22-19(14)15/h4-8,11,13,16-18H,9-10,12H2,1-3H3/b23-13+/t16?,17-,18-/m1/s1 |
| InChIKey | KFKCQEQUJZELAY-AOEBXQBJSA-N |
| XLogP | 5.14 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|