C26H37Cl2N3O8P2 — CID 91826837
(4R)-4-N-[7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid (PubChem CID 91826837) has the molecular formula C26H37Cl2N3O8P2 and a molecular weight of 652.45 g/mol. Its IUPAC name is (4R)-4-N-[7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid.
| Compound Name | (4R)-4-N-[7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 91826837 |
| Molecular Formula | C26H37Cl2N3O8P2 |
| Molecular Weight | 652.45 g/mol |
| Exact Mass | 651.14 |
| IUPAC Name | (4R)-4-N-[7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl]-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1cc(/C=C/c2ccccc2Cl)nc2cc(Cl)ccc12.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C26H31Cl2N3.2H3O4P/c1-4-31(5-2)16-8-9-19(3)29-26-18-22(14-12-20-10-6-7-11-24(20)28)30-25-17-21(27)13-15-23(25)26;2*1-5(2,3)4/h6-7,10-15,17-19H,4-5,8-9,16H2,1-3H3,(H,29,30);2*(H3,1,2,3,4)/b14-12+;;/t19-;;/m1../s1 |
| InChIKey | VWCVSZPKLYFUGK-OCYAFZDLSA-N |
| XLogP | 5.78 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|