C8H10O5 — CID 91827357
(2S,3S)-4,5-dioxo-2-propyloxolane-3-carboxylic acid (PubChem CID 91827357) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is (2S,3S)-4,5-dioxo-2-propyloxolane-3-carboxylic acid.
| Compound Name | (2S,3S)-4,5-dioxo-2-propyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 91827357 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2S,3S)-4,5-dioxo-2-propyloxolane-3-carboxylic acid |
| SMILES | CCC[C@@H]1OC(=O)C(=O)[C@H]1C(=O)O |
| InChI | InChI=1S/C8H10O5/c1-2-3-4-5(7(10)11)6(9)8(12)13-4/h4-5H,2-3H2,1H3,(H,10,11)/t4-,5-/m0/s1 |
| InChIKey | AKWJFOMNTDKSRR-WHFBIAKZSA-N |
| XLogP | -0.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|