About 5-methylbenzo[g][1,3]benzoxazol-2-amine
5-methylbenzo[g][1,3]benzoxazol-2-amine (PubChem CID 91827362) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-methylbenzo[g][1,3]benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-methylbenzo[g][1,3]benzoxazol-2-amine |
| PubChem CID | 91827362 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5-methylbenzo[g][1,3]benzoxazol-2-amine |
| SMILES | Cc1cc2nc(N)oc2c2ccccc12 |
| InChI | InChI=1S/C12H10N2O/c1-7-6-10-11(15-12(13)14-10)9-5-3-2-4-8(7)9/h2-6H,1H3,(H2,13,14) |
| InChIKey | JEGUERWMMMQFJV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylbenzo[g][1,3]benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylbenzo[g][1,3]benzoxazol-2-amine?
The IUPAC name of 5-methylbenzo[g][1,3]benzoxazol-2-amine (CID 91827362) is 5-methylbenzo[g][1,3]benzoxazol-2-amine.
What is the SMILES notation for 5-methylbenzo[g][1,3]benzoxazol-2-amine?
The canonical SMILES for 5-methylbenzo[g][1,3]benzoxazol-2-amine is Cc1cc2nc(N)oc2c2ccccc12.
What is the InChIKey of 5-methylbenzo[g][1,3]benzoxazol-2-amine?
The InChIKey is JEGUERWMMMQFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-7-6-10-11(15-12(13)14-10)9-5-3-2-4-8(7)9/h2-6H,1H3,(H2,13,14).
What are the key properties of 5-methylbenzo[g][1,3]benzoxazol-2-amine?
5-methylbenzo[g][1,3]benzoxazol-2-amine has a molecular weight of 198.22 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylbenzo[g][1,3]benzoxazol-2-amine is sourced from PubChem (CID 91827362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).