About 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol
2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol (PubChem CID 918274) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol.
Molecular Properties
| Compound Name | 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol |
| PubChem CID | 918274 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol |
| SMILES | Oc1ccccc1-c1n[nH]c(-c2ccccn2)n1 |
| InChI | InChI=1S/C13H10N4O/c18-11-7-2-1-5-9(11)12-15-13(17-16-12)10-6-3-4-8-14-10/h1-8,18H,(H,15,16,17) |
| InChIKey | XIHFGQFLZWWLPW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol?
The IUPAC name of 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol (CID 918274) is 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol.
What is the SMILES notation for 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol?
The canonical SMILES for 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol is Oc1ccccc1-c1n[nH]c(-c2ccccn2)n1.
What is the InChIKey of 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol?
The InChIKey is XIHFGQFLZWWLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c18-11-7-2-1-5-9(11)12-15-13(17-16-12)10-6-3-4-8-14-10/h1-8,18H,(H,15,16,17).
What are the key properties of 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol?
2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol has a molecular weight of 238.25 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-pyridin-2-yl-1H-1,2,4-triazol-3-yl)phenol is sourced from PubChem (CID 918274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).