C18H13Cl3FN3O — CID 91827499
6-fluoro-2-methyl-4-[(2,3,6-trichlorophenyl)methylamino]quinoline-8-carboxamide (PubChem CID 91827499) has the molecular formula C18H13Cl3FN3O and a molecular weight of 412.68 g/mol. Its IUPAC name is 6-fluoro-2-methyl-4-[(2,3,6-trichlorophenyl)methylamino]quinoline-8-carboxamide.
| Compound Name | 6-fluoro-2-methyl-4-[(2,3,6-trichlorophenyl)methylamino]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 91827499 |
| Molecular Formula | C18H13Cl3FN3O |
| Molecular Weight | 412.68 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 6-fluoro-2-methyl-4-[(2,3,6-trichlorophenyl)methylamino]quinoline-8-carboxamide |
| SMILES | Cc1cc(NCc2c(Cl)ccc(Cl)c2Cl)c2cc(F)cc(C(N)=O)c2n1 |
| InChI | InChI=1S/C18H13Cl3FN3O/c1-8-4-15(24-7-12-13(19)2-3-14(20)16(12)21)10-5-9(22)6-11(18(23)26)17(10)25-8/h2-6H,7H2,1H3,(H2,23,26)(H,24,25) |
| InChIKey | CFRVEJULVHOSOC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|