C18H24IN7O — CID 91827516
N-[3-[[4-(3-aminopropylamino)-5-iodopyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 91827516) has the molecular formula C18H24IN7O and a molecular weight of 481.34 g/mol. Its IUPAC name is N-[3-[[4-(3-aminopropylamino)-5-iodopyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[4-(3-aminopropylamino)-5-iodopyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91827516 |
| Molecular Formula | C18H24IN7O |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[3-[[4-(3-aminopropylamino)-5-iodopyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | NCCCNc1nc(Nc2cccc(NC(=O)N3CCCC3)c2)ncc1I |
| InChI | InChI=1S/C18H24IN7O/c19-15-12-22-17(25-16(15)21-8-4-7-20)23-13-5-3-6-14(11-13)24-18(27)26-9-1-2-10-26/h3,5-6,11-12H,1-2,4,7-10,20H2,(H,24,27)(H2,21,22,23,25) |
| InChIKey | ZYLHCSSOEGIFAO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|