C12H16BNO2 — CID 91827855
(4-cyanophenyl)-(2,2-dimethylpropoxy)borinic acid (PubChem CID 91827855) has the molecular formula C12H16BNO2 and a molecular weight of 217.08 g/mol. Its IUPAC name is (4-cyanophenyl)-(2,2-dimethylpropoxy)borinic acid.
| Compound Name | (4-cyanophenyl)-(2,2-dimethylpropoxy)borinic acid |
|---|---|
| PubChem CID | 91827855 |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (4-cyanophenyl)-(2,2-dimethylpropoxy)borinic acid |
| SMILES | CC(C)(C)COB(O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H16BNO2/c1-12(2,3)9-16-13(15)11-6-4-10(8-14)5-7-11/h4-7,15H,9H2,1-3H3 |
| InChIKey | WPLFCBKBONNHIB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|