C16H26BNO3 — CID 91828015
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)borinic acid (PubChem CID 91828015) has the molecular formula C16H26BNO3 and a molecular weight of 291.20 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)borinic acid |
|---|---|
| PubChem CID | 91828015 |
| Molecular Formula | C16H26BNO3 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)borinic acid |
| SMILES | CN1CCc2cc(B(O)OC(C)(C)C(C)(C)O)ccc2C1 |
| InChI | InChI=1S/C16H26BNO3/c1-15(2,19)16(3,4)21-17(20)14-7-6-13-11-18(5)9-8-12(13)10-14/h6-7,10,19-20H,8-9,11H2,1-5H3 |
| InChIKey | HHOKFZDJKARDHW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|