About (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid (PubChem CID 91828086) has the molecular formula C13H19BN2O3
and a molecular weight of 262.12 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid.
Molecular Properties
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid |
| PubChem CID | 91828086 |
| Molecular Formula | C13H19BN2O3 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C13H19BN2O3/c1-12(2,17)13(3,4)19-14(18)10-5-7-16-8-6-15-11(16)9-10/h5-9,17-18H,1-4H3 |
| InChIKey | SWPWFMWGNHHETF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid?
The IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid (CID 91828086) is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid.
What is the SMILES notation for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid?
The canonical SMILES for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid is CC(C)(O)C(C)(C)OB(O)c1ccn2ccnc2c1.
What is the InChIKey of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid?
The InChIKey is SWPWFMWGNHHETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BN2O3/c1-12(2,17)13(3,4)19-14(18)10-5-7-16-8-6-15-11(16)9-10/h5-9,17-18H,1-4H3.
What are the key properties of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid?
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid has a molecular weight of 262.12 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-imidazo[1,2-a]pyridin-7-ylborinic acid is sourced from PubChem (CID 91828086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).