About 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide
2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 91828804) has the molecular formula C17H17FN4O3
and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide |
| PubChem CID | 91828804 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(Cc2cocn2)Cc2cocn2)cc1F |
| InChI | InChI=1S/C17H17FN4O3/c1-12-2-3-13(4-16(12)18)21-17(23)7-22(5-14-8-24-10-19-14)6-15-9-25-11-20-15/h2-4,8-11H,5-7H2,1H3,(H,21,23) |
| InChIKey | BPUGAIIQWNYHFD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide?
The IUPAC name of 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide (CID 91828804) is 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide.
What is the SMILES notation for 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide?
The canonical SMILES for 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide is Cc1ccc(NC(=O)CN(Cc2cocn2)Cc2cocn2)cc1F.
What is the InChIKey of 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide?
The InChIKey is BPUGAIIQWNYHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN4O3/c1-12-2-3-13(4-16(12)18)21-17(23)7-22(5-14-8-24-10-19-14)6-15-9-25-11-20-15/h2-4,8-11H,5-7H2,1H3,(H,21,23).
What are the key properties of 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide?
2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide has a molecular weight of 344.35 g/mol, XLogP of 2.75, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(1,3-oxazol-4-ylmethyl)amino]-N-(3-fluoro-4-methylphenyl)acetamide is sourced from PubChem (CID 91828804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).