About N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine (PubChem CID 91828977) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine |
| PubChem CID | 91828977 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine |
| SMILES | Cc1noc(CN(C)CCC2CCOCC2)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-10-13-12(17-14-10)9-15(2)6-3-11-4-7-16-8-5-11/h11H,3-9H2,1-2H3 |
| InChIKey | HENVRRPBRQSUGG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine?
The IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine (CID 91828977) is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine.
What is the SMILES notation for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine?
The canonical SMILES for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine is Cc1noc(CN(C)CCC2CCOCC2)n1.
What is the InChIKey of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine?
The InChIKey is HENVRRPBRQSUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-10-13-12(17-14-10)9-15(2)6-3-11-4-7-16-8-5-11/h11H,3-9H2,1-2H3.
What are the key properties of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine?
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine has a molecular weight of 239.32 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-(oxan-4-yl)ethanamine is sourced from PubChem (CID 91828977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).