About N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide
N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 91829273) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide |
| PubChem CID | 91829273 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | CO[C@H]1CN(C(C)C)C[C@@H]1NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C12H20N4O2/c1-8(2)16-5-10(11(6-16)18-3)15-12(17)9-4-13-7-14-9/h4,7-8,10-11H,5-6H2,1-3H3,(H,13,14)(H,15,17)/t10-,11-/m0/s1 |
| InChIKey | VRLNZLRURRZNEC-QWRGUYRKSA-N |
| XLogP | 0.25 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide?
The IUPAC name of N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide (CID 91829273) is N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide.
What is the SMILES notation for N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide?
The canonical SMILES for N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide is CO[C@H]1CN(C(C)C)C[C@@H]1NC(=O)c1cnc[nH]1.
What is the InChIKey of N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide?
The InChIKey is VRLNZLRURRZNEC-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-8(2)16-5-10(11(6-16)18-3)15-12(17)9-4-13-7-14-9/h4,7-8,10-11H,5-6H2,1-3H3,(H,13,14)(H,15,17)/t10-,11-/m0/s1.
What are the key properties of N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide?
N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide has a molecular weight of 252.32 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-4-methoxy-1-propan-2-ylpyrrolidin-3-yl]-1H-imidazole-5-carboxamide is sourced from PubChem (CID 91829273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).