About N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide
N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 91832568) has the molecular formula C13H19N3O3S
and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
| PubChem CID | 91832568 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)c1nc(C(=O)NCCN2CCCOC2=O)cs1 |
| InChI | InChI=1S/C13H19N3O3S/c1-9(2)12-15-10(8-20-12)11(17)14-4-6-16-5-3-7-19-13(16)18/h8-9H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | GBTWLDHNOFOXEP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide (CID 91832568) is N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide is CC(C)c1nc(C(=O)NCCN2CCCOC2=O)cs1.
What is the InChIKey of N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide?
The InChIKey is GBTWLDHNOFOXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3S/c1-9(2)12-15-10(8-20-12)11(17)14-4-6-16-5-3-7-19-13(16)18/h8-9H,3-7H2,1-2H3,(H,14,17).
What are the key properties of N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide?
N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide has a molecular weight of 297.38 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 91832568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).