About N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide
N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide (PubChem CID 91833324) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide.
Molecular Properties
| Compound Name | N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide |
| PubChem CID | 91833324 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide |
| SMILES | CCC(=O)NCC(=O)NC(CC)c1nc(C)no1 |
| InChI | InChI=1S/C11H18N4O3/c1-4-8(11-13-7(3)15-18-11)14-10(17)6-12-9(16)5-2/h8H,4-6H2,1-3H3,(H,12,16)(H,14,17) |
| InChIKey | QFAJDDNNDCEHBK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide?
The IUPAC name of N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide (CID 91833324) is N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide.
What is the SMILES notation for N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide?
The canonical SMILES for N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide is CCC(=O)NCC(=O)NC(CC)c1nc(C)no1.
What is the InChIKey of N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide?
The InChIKey is QFAJDDNNDCEHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-4-8(11-13-7(3)15-18-11)14-10(17)6-12-9(16)5-2/h8H,4-6H2,1-3H3,(H,12,16)(H,14,17).
What are the key properties of N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide?
N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide has a molecular weight of 254.29 g/mol, XLogP of 0.47, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(3-methyl-1,2,4-oxadiazol-5-yl)propylamino]-2-oxoethyl]propanamide is sourced from PubChem (CID 91833324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).