C15H22N6O3S — CID 91833836
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propanamide (PubChem CID 91833836) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propanamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propanamide |
|---|---|
| PubChem CID | 91833836 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propanamide |
| SMILES | CCc1nnc(NC(=O)CCN2CCN3C(=O)CN(C)C(=O)C3C2)s1 |
| InChI | InChI=1S/C15H22N6O3S/c1-3-12-17-18-15(25-12)16-11(22)4-5-20-6-7-21-10(8-20)14(24)19(2)9-13(21)23/h10H,3-9H2,1-2H3,(H,16,18,22) |
| InChIKey | WZPWUBNHPNVJBR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |