C20H24N4O2 — CID 91833864
4-(dimethylamino)-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 91833864) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-(dimethylamino)-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 91833864 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-(dimethylamino)-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CN(C)c1ccc(C(=O)N(Cc2cccnc2)C[C@@H]2CCC(=O)N2)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-23(2)18-8-5-16(6-9-18)20(26)24(13-15-4-3-11-21-12-15)14-17-7-10-19(25)22-17/h3-6,8-9,11-12,17H,7,10,13-14H2,1-2H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | BMKSBHALNBUEDP-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |