C17H20N6O2S — CID 91834470
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxamide (PubChem CID 91834470) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91834470 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCc1n[nH]c2c1CCCCC2)c1ccc(CSc2ncn[nH]2)o1 |
| InChI | InChI=1S/C17H20N6O2S/c24-16(15-7-6-11(25-15)9-26-17-19-10-20-23-17)18-8-14-12-4-2-1-3-5-13(12)21-22-14/h6-7,10H,1-5,8-9H2,(H,18,24)(H,21,22)(H,19,20,23) |
| InChIKey | JCAGXUHMELDMPT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |