About (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid
(3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid (PubChem CID 91834882) has the molecular formula C13H19N3O4
and a molecular weight of 281.31 g/mol. Its IUPAC name is (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid |
| PubChem CID | 91834882 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cc(=O)n(CCN2CCC[C@H](C(=O)O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H19N3O4/c1-9-7-11(17)16(13(20)14-9)6-5-15-4-2-3-10(8-15)12(18)19/h7,10H,2-6,8H2,1H3,(H,14,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | ACVDAPFFNNVTJO-JTQLQIEISA-N |
| XLogP | -0.36 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid (CID 91834882) is (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid is Cc1cc(=O)n(CCN2CCC[C@H](C(=O)O)C2)c(=O)[nH]1.
What is the InChIKey of (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid?
The InChIKey is ACVDAPFFNNVTJO-JTQLQIEISA-N. The full InChI is InChI=1S/C13H19N3O4/c1-9-7-11(17)16(13(20)14-9)6-5-15-4-2-3-10(8-15)12(18)19/h7,10H,2-6,8H2,1H3,(H,14,20)(H,18,19)/t10-/m0/s1.
What are the key properties of (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid?
(3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid has a molecular weight of 281.31 g/mol, XLogP of -0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[2-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 91834882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).