C18H27NO5 — CID 91835511
N-(2,2-dimethyloxan-4-yl)-2,3,4-trimethoxy-N-methylbenzamide (PubChem CID 91835511) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-2,3,4-trimethoxy-N-methylbenzamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-2,3,4-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 91835511 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-2,3,4-trimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C2CCOC(C)(C)C2)c(OC)c1OC |
| InChI | InChI=1S/C18H27NO5/c1-18(2)11-12(9-10-24-18)19(3)17(20)13-7-8-14(21-4)16(23-6)15(13)22-5/h7-8,12H,9-11H2,1-6H3 |
| InChIKey | FAFNFNROVNWWCA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |