About 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 91835961) has the molecular formula C19H24N4O3
and a molecular weight of 356.43 g/mol. Its IUPAC name is 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 91835961 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1cccc(OCCCN(C)Cc2cc(=O)n3[nH]c(C)cc3n2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-14-10-18-20-15(11-19(24)23(18)21-14)13-22(2)8-5-9-26-17-7-4-6-16(12-17)25-3/h4,6-7,10-12,21H,5,8-9,13H2,1-3H3 |
| InChIKey | XTAXFYSXHOUFFE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 91835961) is 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is COc1cccc(OCCCN(C)Cc2cc(=O)n3[nH]c(C)cc3n2)c1.
What is the InChIKey of 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is XTAXFYSXHOUFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O3/c1-14-10-18-20-15(11-19(24)23(18)21-14)13-22(2)8-5-9-26-17-7-4-6-16(12-17)25-3/h4,6-7,10-12,21H,5,8-9,13H2,1-3H3.
What are the key properties of 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 356.43 g/mol, XLogP of 2.24, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(3-methoxyphenoxy)propyl-methylamino]methyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 91835961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).