About 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide
2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide (PubChem CID 91837752) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide |
| PubChem CID | 91837752 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN(CC)Cc1noc(C)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-4-6-12-11(16)8-15(5-2)7-10-13-9(3)17-14-10/h4H,1,5-8H2,2-3H3,(H,12,16) |
| InChIKey | GXRGIKHYIHQKEL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide?
The IUPAC name of 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide (CID 91837752) is 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide.
What is the SMILES notation for 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide?
The canonical SMILES for 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide is C=CCNC(=O)CN(CC)Cc1noc(C)n1.
What is the InChIKey of 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide?
The InChIKey is GXRGIKHYIHQKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-4-6-12-11(16)8-15(5-2)7-10-13-9(3)17-14-10/h4H,1,5-8H2,2-3H3,(H,12,16).
What are the key properties of 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide?
2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide has a molecular weight of 238.29 g/mol, XLogP of 0.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-N-prop-2-enylacetamide is sourced from PubChem (CID 91837752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).