C21H29N3O3 — CID 91838125
[1-(oxolane-2-carbonyl)piperidin-4-yl]-(4-pyridin-4-ylpiperidin-1-yl)methanone (PubChem CID 91838125) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is [1-(oxolane-2-carbonyl)piperidin-4-yl]-(4-pyridin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(oxolane-2-carbonyl)piperidin-4-yl]-(4-pyridin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 91838125 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | [1-(oxolane-2-carbonyl)piperidin-4-yl]-(4-pyridin-4-ylpiperidin-1-yl)methanone |
| SMILES | O=C(C1CCN(C(=O)C2CCCO2)CC1)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C21H29N3O3/c25-20(23-11-5-17(6-12-23)16-3-9-22-10-4-16)18-7-13-24(14-8-18)21(26)19-2-1-15-27-19/h3-4,9-10,17-19H,1-2,5-8,11-15H2 |
| InChIKey | PAYHSJSVIONJLR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |