About N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide
N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide (PubChem CID 91838272) has the molecular formula C13H23N3O2S2
and a molecular weight of 317.48 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide |
| PubChem CID | 91838272 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCN1CCCCC1c1nccs1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-15(2)20(17,18)11-5-9-16-8-4-3-6-12(16)13-14-7-10-19-13/h7,10,12H,3-6,8-9,11H2,1-2H3 |
| InChIKey | OYKVFPJQQBVFGH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide?
The IUPAC name of N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide (CID 91838272) is N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide.
What is the SMILES notation for N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide?
The canonical SMILES for N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide is CN(C)S(=O)(=O)CCCN1CCCCC1c1nccs1.
What is the InChIKey of N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide?
The InChIKey is OYKVFPJQQBVFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S2/c1-15(2)20(17,18)11-5-9-16-8-4-3-6-12(16)13-14-7-10-19-13/h7,10,12H,3-6,8-9,11H2,1-2H3.
What are the key properties of N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide?
N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide has a molecular weight of 317.48 g/mol, XLogP of 1.95, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propane-1-sulfonamide is sourced from PubChem (CID 91838272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).