About (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide
(2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 91838589) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide |
| PubChem CID | 91838589 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C)c2c(=O)cc(CN3CCC[C@@H]3C(N)=O)[nH]c12 |
| InChI | InChI=1S/C17H21N3O2/c1-10-5-6-11(2)16-15(10)14(21)8-12(19-16)9-20-7-3-4-13(20)17(18)22/h5-6,8,13H,3-4,7,9H2,1-2H3,(H2,18,22)(H,19,21)/t13-/m1/s1 |
| InChIKey | MIHMKCVGJBMORU-CYBMUJFWSA-N |
| XLogP | 1.59 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide?
The IUPAC name of (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide (CID 91838589) is (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide?
The canonical SMILES for (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide is Cc1ccc(C)c2c(=O)cc(CN3CCC[C@@H]3C(N)=O)[nH]c12.
What is the InChIKey of (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide?
The InChIKey is MIHMKCVGJBMORU-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-10-5-6-11(2)16-15(10)14(21)8-12(19-16)9-20-7-3-4-13(20)17(18)22/h5-6,8,13H,3-4,7,9H2,1-2H3,(H2,18,22)(H,19,21)/t13-/m1/s1.
What are the key properties of (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide?
(2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide has a molecular weight of 299.37 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(5,8-dimethyl-4-oxo-1H-quinolin-2-yl)methyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 91838589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).