C20H20N3O3+ — CID 9183905
1-(4-methylphenyl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 9183905) has the molecular formula C20H20N3O3+ and a molecular weight of 350.40 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-methylphenyl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9183905 |
| Molecular Formula | C20H20N3O3+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-(4-methylphenyl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | Cc1ccc(N2C(=O)C(=O)N(C[NH+]3CCc4ccccc4C3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-14-6-8-17(9-7-14)23-19(25)18(24)22(20(23)26)13-21-11-10-15-4-2-3-5-16(15)12-21/h2-9H,10-13H2,1H3/p+1 |
| InChIKey | XMCFUACZOVIVFI-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|