About N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine
N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine (PubChem CID 91839527) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine |
| PubChem CID | 91839527 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine |
| SMILES | Cc1nccn1CCCN(C)CC1COCCO1 |
| InChI | InChI=1S/C13H23N3O2/c1-12-14-4-7-16(12)6-3-5-15(2)10-13-11-17-8-9-18-13/h4,7,13H,3,5-6,8-11H2,1-2H3 |
| InChIKey | ZVVHVTRVFIJNKA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine?
The IUPAC name of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine (CID 91839527) is N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine.
What is the SMILES notation for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine?
The canonical SMILES for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine is Cc1nccn1CCCN(C)CC1COCCO1.
What is the InChIKey of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine?
The InChIKey is ZVVHVTRVFIJNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-12-14-4-7-16(12)6-3-5-15(2)10-13-11-17-8-9-18-13/h4,7,13H,3,5-6,8-11H2,1-2H3.
What are the key properties of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine?
N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine has a molecular weight of 253.35 g/mol, XLogP of 0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3-(2-methylimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 91839527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).