About 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine
1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine (PubChem CID 91839897) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine |
| PubChem CID | 91839897 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine |
| SMILES | COc1ccnc(CN(Cc2cocn2)Cc2cocn2)c1 |
| InChI | InChI=1S/C15H16N4O3/c1-20-15-2-3-16-12(4-15)5-19(6-13-8-21-10-17-13)7-14-9-22-11-18-14/h2-4,8-11H,5-7H2,1H3 |
| InChIKey | XIBBGQUTWLVKTA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine?
The IUPAC name of 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine (CID 91839897) is 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine.
What is the SMILES notation for 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine?
The canonical SMILES for 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine is COc1ccnc(CN(Cc2cocn2)Cc2cocn2)c1.
What is the InChIKey of 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine?
The InChIKey is XIBBGQUTWLVKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-20-15-2-3-16-12(4-15)5-19(6-13-8-21-10-17-13)7-14-9-22-11-18-14/h2-4,8-11H,5-7H2,1H3.
What are the key properties of 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine?
1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine has a molecular weight of 300.32 g/mol, XLogP of 2.27, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-2-pyridinyl)-N,N-bis(1,3-oxazol-4-ylmethyl)methanamine is sourced from PubChem (CID 91839897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).