C19H24FN3O2 — CID 91840959
N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(1H-pyrazol-4-yl)butanamide (PubChem CID 91840959) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(1H-pyrazol-4-yl)butanamide.
| Compound Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 91840959 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(1H-pyrazol-4-yl)butanamide |
| SMILES | O=C(CCCc1cn[nH]c1)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C19H24FN3O2/c20-17-5-2-4-16(11-17)19(7-9-25-10-8-19)14-21-18(24)6-1-3-15-12-22-23-13-15/h2,4-5,11-13H,1,3,6-10,14H2,(H,21,24)(H,22,23) |
| InChIKey | ABKOXBPIUBDOCM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |