C14H22N4O — CID 91841444
1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-pyrazol-1-ylbutan-1-one (PubChem CID 91841444) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-pyrazol-1-ylbutan-1-one.
| Compound Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-pyrazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 91841444 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-pyrazol-1-ylbutan-1-one |
| SMILES | CN1CC[C@H]2CN(C(=O)CCCn3cccn3)C[C@H]21 |
| InChI | InChI=1S/C14H22N4O/c1-16-9-5-12-10-17(11-13(12)16)14(19)4-2-7-18-8-3-6-15-18/h3,6,8,12-13H,2,4-5,7,9-11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | BGOXCRPSXFEVNP-QWHCGFSZSA-N |
| XLogP | 0.83 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |