C16H28N4O — CID 91841529
3-[propan-2-yl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]-N-prop-2-enylpropanamide (PubChem CID 91841529) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-[propan-2-yl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]-N-prop-2-enylpropanamide.
| Compound Name | 3-[propan-2-yl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 91841529 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-[propan-2-yl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CCN(Cc1c(C)nn(C)c1C)C(C)C |
| InChI | InChI=1S/C16H28N4O/c1-7-9-17-16(21)8-10-20(12(2)3)11-15-13(4)18-19(6)14(15)5/h7,12H,1,8-11H2,2-6H3,(H,17,21) |
| InChIKey | HZVWXXLBNCSFAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|