C19H26ClN3O3 — CID 91841580
3-[(4aR,8aR)-7-acetyl-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-N-(3-chlorophenyl)propanamide (PubChem CID 91841580) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-[(4aR,8aR)-7-acetyl-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-N-(3-chlorophenyl)propanamide.
| Compound Name | 3-[(4aR,8aR)-7-acetyl-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-N-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 91841580 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[(4aR,8aR)-7-acetyl-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-N-(3-chlorophenyl)propanamide |
| SMILES | CC(=O)N1CC[C@]2(O)CCN(CCC(=O)Nc3cccc(Cl)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-14(24)23-10-7-19(26)6-9-22(12-15(19)13-23)8-5-18(25)21-17-4-2-3-16(20)11-17/h2-4,11,15,26H,5-10,12-13H2,1H3,(H,21,25)/t15-,19-/m1/s1 |
| InChIKey | WJJYMVLMEBKWQW-DNVCBOLYSA-N |
| XLogP | 1.97 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |