C20H26N4 — CID 91841741
(9aS)-2-[(4-methyl-6-phenylpyrimidin-2-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 91841741) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is (9aS)-2-[(4-methyl-6-phenylpyrimidin-2-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (9aS)-2-[(4-methyl-6-phenylpyrimidin-2-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 91841741 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (9aS)-2-[(4-methyl-6-phenylpyrimidin-2-yl)methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | Cc1cc(-c2ccccc2)nc(CN2CCCN3CCC[C@H]3C2)n1 |
| InChI | InChI=1S/C20H26N4/c1-16-13-19(17-7-3-2-4-8-17)22-20(21-16)15-23-10-6-12-24-11-5-9-18(24)14-23/h2-4,7-8,13,18H,5-6,9-12,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | WQFGUILSDGLMGH-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |