C17H25N3O4S — CID 91842161
4-(ethylsulfonylamino)-N-methyl-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide (PubChem CID 91842161) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-N-methyl-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide.
| Compound Name | 4-(ethylsulfonylamino)-N-methyl-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 91842161 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-(ethylsulfonylamino)-N-methyl-N-[2-(2-oxopiperidin-1-yl)ethyl]benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)N(C)CCN2CCCCC2=O)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-3-25(23,24)18-15-9-7-14(8-10-15)17(22)19(2)12-13-20-11-5-4-6-16(20)21/h7-10,18H,3-6,11-13H2,1-2H3 |
| InChIKey | IHPGCRITZJIXAV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |