C15H28N4O2S — CID 91842438
3-[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]-N,N-dimethylpropane-1-sulfonamide (PubChem CID 91842438) has the molecular formula C15H28N4O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is 3-[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 91842438 |
| Molecular Formula | C15H28N4O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(CCCS(=O)(=O)N(C)C)Cc1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C15H28N4O2S/c1-18(2)22(20,21)11-7-10-19(3)12-15-13-8-5-4-6-9-14(13)16-17-15/h4-12H2,1-3H3,(H,16,17) |
| InChIKey | VANNSKLAAQYQJN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |