About N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide (PubChem CID 9184317) has the molecular formula C14H10ClFN4O2S
and a molecular weight of 352.78 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 9184317 |
| Molecular Formula | C14H10ClFN4O2S |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)ccc1-n1cncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10ClFN4O2S/c15-10-1-6-14(20-9-17-8-18-20)13(7-10)19-23(21,22)12-4-2-11(16)3-5-12/h1-9,19H |
| InChIKey | MSIPWVKVSZYKSV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide (CID 9184317) is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide is O=S(=O)(Nc1cc(Cl)ccc1-n1cncn1)c1ccc(F)cc1.
What is the InChIKey of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide?
The InChIKey is MSIPWVKVSZYKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFN4O2S/c15-10-1-6-14(20-9-17-8-18-20)13(7-10)19-23(21,22)12-4-2-11(16)3-5-12/h1-9,19H.
What are the key properties of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide?
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide has a molecular weight of 352.78 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 9184317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).