About N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide (PubChem CID 91843426) has the molecular formula C13H23N5O3S
and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide.
Molecular Properties
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide |
| PubChem CID | 91843426 |
| Molecular Formula | C13H23N5O3S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide |
| SMILES | CS(=O)(=O)NCCC(=O)NCc1nncn1C1CCCCC1 |
| InChI | InChI=1S/C13H23N5O3S/c1-22(20,21)16-8-7-13(19)14-9-12-17-15-10-18(12)11-5-3-2-4-6-11/h10-11,16H,2-9H2,1H3,(H,14,19) |
| InChIKey | GURFESSGZDWVRQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide?
The IUPAC name of N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide (CID 91843426) is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide.
What is the SMILES notation for N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide?
The canonical SMILES for N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide is CS(=O)(=O)NCCC(=O)NCc1nncn1C1CCCCC1.
What is the InChIKey of N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide?
The InChIKey is GURFESSGZDWVRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O3S/c1-22(20,21)16-8-7-13(19)14-9-12-17-15-10-18(12)11-5-3-2-4-6-11/h10-11,16H,2-9H2,1H3,(H,14,19).
What are the key properties of N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide?
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide has a molecular weight of 329.43 g/mol, XLogP of 0.34, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-(methanesulfonamido)propanamide is sourced from PubChem (CID 91843426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).