C17H21N5O2 — CID 91844186
[2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone (PubChem CID 91844186) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone.
| Compound Name | [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 91844186 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [2-(2-methylpropyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)methanone |
| SMILES | CC(C)Cc1ncc2c(n1)CN(C(=O)c1n[nH]c3c1COCC3)C2 |
| InChI | InChI=1S/C17H21N5O2/c1-10(2)5-15-18-6-11-7-22(8-14(11)19-15)17(23)16-12-9-24-4-3-13(12)20-21-16/h6,10H,3-5,7-9H2,1-2H3,(H,20,21) |
| InChIKey | QCBJWNYGQWUPIL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |